
CAS 1190322-15-6
:6-Hydroxy-4-methyl-2(3H)-benzothiazolone
Description:
6-Hydroxy-4-methyl-2(3H)-benzothiazolone, identified by its CAS number 1190322-15-6, is an organic compound that features a benzothiazole ring, which is a bicyclic structure containing both a benzene and a thiazole moiety. This compound is characterized by the presence of a hydroxyl group (-OH) at the 6-position and a methyl group (-CH3) at the 4-position of the benzothiazole framework. It typically exhibits properties such as solubility in polar solvents, which is influenced by the hydroxyl group, and may show potential biological activity due to its structural features. The compound can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it of interest in synthetic organic chemistry. Additionally, its derivatives may have applications in fields such as pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its reactivity and biological properties. Safety data and handling precautions should be consulted when working with this substance.
Formula:C8H7NO2S
InChI:InChI=1S/C8H7NO2S/c1-4-2-5(10)3-6-7(4)9-8(11)12-6/h2-3,10H,1H3,(H,9,11)
InChI key:InChIKey=GJWZRNDOYJNQFF-UHFFFAOYSA-N
SMILES:CC1=C2C(SC(=O)N2)=CC(O)=C1
Synonyms:- 2,6-Dihydroxy-4-methylbenzothiazole
- 6-Hydroxy-4-methyl-2(3H)-benzothiazolone
- 2(3H)-Benzothiazolone, 6-hydroxy-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
