CAS 1190322-20-3

5-Methoxy-1H-pyrrolo[2,3-b]pyridin-3-amine

Description:

5-Methoxy-1H-pyrrolo[2,3-b]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine moiety. This compound features a methoxy group (-OCH3) at the 5-position of the pyrrole ring and an amino group (-NH2) at the 3-position of the pyridine ring, contributing to its potential biological activity. The presence of these functional groups suggests that it may engage in hydrogen bonding and participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to pharmacological effects. Additionally, the compound's solubility and stability can be influenced by the methoxy and amino substituents, affecting its bioavailability and therapeutic efficacy. As with many heterocycles, its properties may also include moderate to high melting points and specific reactivity patterns, which are essential for its application in research and development.

Formula: C₈H₉N₃O

InChI: InChI=1S/C8H9N3O/c1-12-5-2-6-7(9)4-11-8(6)10-3-5/h2-4H,9H2,1H3,(H,10,11)

InChI key: InChIKey=NHHBWDVLZBXAHT-UHFFFAOYSA-N

SMILES: NC=1C=2C(=NC=C(OC)C2)NC1

Synonyms:

• 5-Methoxy-1H-pyrrolo[2,3-b]pyridin-3-amine
• 1H-Pyrrolo[2,3-b]pyridin-3-amine, 5-methoxy-

1H-Pyrrolo[2,3-b]pyridin-3-amine, 5-methoxy-

CAS: 1190322-20-3

Formula: C₈H₉N₃O

Molecular weight: 163.1766

Ref: IN-DA000I14