CymitQuimica logo

CAS 1190322-22-5

:

4,5-Dibromo-1H-pyrrolo[2,3-b]pyridine

Description:
4,5-Dibromo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two bromine substituents at the 4 and 5 positions of the pyrrole ring, enhancing its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of bromine atoms can influence its electronic properties, making it a candidate for use in pharmaceuticals, agrochemicals, and materials science. Additionally, the compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Its structure allows for potential interactions with biological targets, making it a subject of interest in drug discovery. As with many brominated compounds, care should be taken regarding environmental and health impacts, as brominated substances can pose risks if not handled properly. Overall, 4,5-Dibromo-1H-pyrrolo[2,3-b]pyridine is a versatile compound with significant implications in various fields of research.
Formula:C7H4Br2N2
InChI:InChI=1S/C7H4Br2N2/c8-5-3-11-7-4(6(5)9)1-2-10-7/h1-3H,(H,10,11)
InChI key:InChIKey=ARSHXBJVSQOUES-UHFFFAOYSA-N
SMILES:BrC1=C2C(=NC=C1Br)NC=C2
Synonyms:
  • 4,5-Dibromo-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 4,5-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.