CymitQuimica logo

CAS 1190322-27-0

:

4-Chloro-1,3-dihydro-6-methyl-2H-pyrrolo[2,3-b]pyridin-2-one

Description:
4-Chloro-1,3-dihydro-6-methyl-2H-pyrrolo[2,3-b]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrolidine and pyridine moiety. The presence of a chlorine atom at the 4-position and a methyl group at the 6-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of nitrogen-containing rings that can interact with biological targets. The compound may also display interesting properties such as fluorescence or specific reactivity patterns, making it a subject of interest in synthetic organic chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C8H7ClN2O
InChI:InChI=1S/C8H7ClN2O/c1-4-2-6(9)5-3-7(12)11-8(5)10-4/h2H,3H2,1H3,(H,10,11,12)
InChI key:InChIKey=WVQPNTOUQCWYFI-UHFFFAOYSA-N
SMILES:ClC1=C2C(NC(=O)C2)=NC(C)=C1
Synonyms:
  • 2H-Pyrrolo[2,3-b]pyridin-2-one, 4-chloro-1,3-dihydro-6-methyl-
  • 4-Chloro-1,3-dihydro-6-methyl-2H-pyrrolo[2,3-b]pyridin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.