
CAS 1190322-30-5
:6-Chloro-1,3-dihydro-4-iodo-2H-pyrrolo[2,3-b]pyridin-2-one
Description:
6-Chloro-1,3-dihydro-4-iodo-2H-pyrrolo[2,3-b]pyridin-2-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyrrole and pyridine moieties. The presence of chlorine and iodine substituents contributes to its unique reactivity and potential biological activity. This compound typically exhibits moderate to high solubility in polar organic solvents, which is influenced by its functional groups. It may display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the compound's stability can be affected by environmental factors such as light and temperature, which is important for storage and handling. Overall, 6-Chloro-1,3-dihydro-4-iodo-2H-pyrrolo[2,3-b]pyridin-2-one represents a valuable compound for research in drug development and synthetic chemistry.
Formula:C7H4ClIN2O
InChI:InChI=1S/C7H4ClIN2O/c8-5-2-4(9)3-1-6(12)11-7(3)10-5/h2H,1H2,(H,10,11,12)
InChI key:InChIKey=PEWRVRXSFAGKSP-UHFFFAOYSA-N
SMILES:IC1=C2C(NC(=O)C2)=NC(Cl)=C1
Synonyms:- 2H-Pyrrolo[2,3-b]pyridin-2-one, 6-chloro-1,3-dihydro-4-iodo-
- 6-Chloro-1,3-dihydro-4-iodo-2H-pyrrolo[2,3-b]pyridin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-Pyrrolo[2,3-b]pyridin-2-one, 6-chloro-1,3-dihydro-4-iodo-
CAS:Formula:C7H4ClIN2OMolecular weight:294.4769
