CymitQuimica logo

CAS 1190322-35-0

:

3-Amino-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile

Description:
3-Amino-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrrole functionalities. This compound features an amino group and a cyano group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the amino group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in the synthesis of more complex molecules. The cyano group can also serve as a versatile functional group for further derivatization. Additionally, the compound's structural features may influence its biological activity, potentially making it a candidate for drug development. Its solubility, stability, and reactivity can vary based on the surrounding conditions, such as pH and solvent polarity. Overall, 3-Amino-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile is of interest in both synthetic organic chemistry and pharmaceutical research due to its distinctive structure and functional groups.
Formula:C8H6N4
InChI:InChI=1S/C8H6N4/c9-1-5-2-11-4-7-8(5)6(10)3-12-7/h2-4,12H,10H2
InChI key:InChIKey=UKHYYZOEGXPTQF-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(NC=C2N)=CN=C1
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridine-4-carbonitrile, 3-amino-
  • 3-Amino-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.