
CAS 1190322-39-4
:5-Methoxy-4-nitro-1H-pyrrolo[2,3-b]pyridine
Description:
5-Methoxy-4-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its pyrrolo[2,3-b]pyridine core, which features a methoxy group and a nitro substituent. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, reflecting its aromatic nature. The presence of the methoxy group contributes to its electron-donating properties, while the nitro group serves as an electron-withdrawing substituent, influencing its reactivity and potential applications in medicinal chemistry. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which can be explored through various assays. As with many heterocycles, it may also participate in diverse chemical reactions, including electrophilic substitutions and nucleophilic attacks, depending on the reaction conditions. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose hazards in certain contexts.
Formula:C8H7N3O3
InChI:InChI=1S/C8H7N3O3/c1-14-6-4-10-8-5(2-3-9-8)7(6)11(12)13/h2-4H,1H3,(H,9,10)
InChI key:InChIKey=YSKIQULWDDKCSW-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=NC=C1OC)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 5-methoxy-4-nitro-
- 5-Methoxy-4-nitro-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
