CAS 1190322-43-0

3-Chloro-6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine

Description:

3-Chloro-6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a chlorine atom and a trifluoromethyl group. The presence of the chlorine atom typically enhances the compound's reactivity, while the trifluoromethyl group can significantly influence its electronic properties, making it more lipophilic and potentially increasing its biological activity. This compound is likely to exhibit a range of chemical behaviors, including potential interactions with various biological targets, which may be of interest in pharmaceutical research. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, affecting its solubility and stability in different solvents. Additionally, the compound's fluorinated group may confer unique properties such as increased metabolic stability. Overall, 3-Chloro-6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a compound of interest in medicinal chemistry and materials science due to its distinctive structural features and potential applications.

Formula: C₈H₄ClF₃N₂

InChI: InChI=1S/C8H4ClF3N2/c9-5-3-13-7-4(5)1-2-6(14-7)8(10,11)12/h1-3H,(H,13,14)

InChI key: InChIKey=ZWBIRTYJPZIUOH-UHFFFAOYSA-N

SMILES: ClC=1C=2C(=NC(C(F)(F)F)=CC2)NC1

Synonyms:

• 3-Chloro-6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 3-chloro-6-(trifluoromethyl)-

1H-Pyrrolo[2,3-b]pyridine, 3-chloro-6-(trifluoromethyl)-

CAS: 1190322-43-0

Formula: C₈H₄ClF₃N₂

Molecular weight: 220.579

Ref: IN-DA000I1Y