CAS 1190322-48-5

3-Iodo-1H-pyrrolo[2,3-b]pyridin-5-ol

Description:

3-Iodo-1H-pyrrolo[2,3-b]pyridin-5-ol is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. The presence of an iodine atom at the 3-position and a hydroxyl group at the 5-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, while its iodine substituent can influence its lipophilicity and reactivity. The compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and material science. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways or as a building block for more complex molecules. As with many iodine-containing compounds, it may also exhibit unique properties such as enhanced stability or specific interactions with biological targets. Safety and handling precautions should be observed due to the presence of iodine and the potential for biological activity.

Formula: C₇H₅IN₂O

InChI: InChI=1S/C7H5IN2O/c8-6-3-10-7-5(6)1-4(11)2-9-7/h1-3,11H,(H,9,10)

InChI key: InChIKey=DMOYKOPOJMHROR-UHFFFAOYSA-N

SMILES: IC=1C=2C(=NC=C(O)C2)NC1

Synonyms:

• 3-Iodo-1H-pyrrolo[2,3-b]pyridin-5-ol
• 1H-Pyrrolo[2,3-b]pyridin-5-ol, 3-iodo-

1H-Pyrrolo[2,3-b]pyridin-5-ol, 3-iodo-

CAS: 1190322-48-5

Formula: C₇H₅IN₂O

Purity: 97%

Molecular weight: 260.0319

Ref: IN-DA000I1T