
CAS 1190322-49-6
:3-Bromo-6-chloro-4-methoxy-1H-pyrrolo[2,3-b]pyridine
Description:
3-Bromo-6-chloro-4-methoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrrole rings. This compound features a bromine atom at the 3-position and a chlorine atom at the 6-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a methoxy group at the 4-position enhances its solubility and may influence its biological activity. The unique arrangement of halogen and methoxy substituents can affect the electronic properties of the molecule, making it of interest in the development of pharmaceuticals, particularly in targeting specific biological pathways. Additionally, the compound's structural features may allow for various synthetic modifications, enabling the exploration of derivatives with enhanced efficacy or selectivity. Overall, 3-Bromo-6-chloro-4-methoxy-1H-pyrrolo[2,3-b]pyridine represents a valuable scaffold in organic synthesis and drug discovery.
Formula:C8H6BrClN2O
InChI:InChI=1S/C8H6BrClN2O/c1-13-5-2-6(10)12-8-7(5)4(9)3-11-8/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=ZMZOQHGTGLWNEZ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(NC=C2Br)=NC(Cl)=C1
Synonyms:- 3-Bromo-6-chloro-4-methoxy-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 3-bromo-6-chloro-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrrolo[2,3-b]pyridine, 3-bromo-6-chloro-4-methoxy-
CAS:Formula:C8H6BrClN2OMolecular weight:261.503
