CAS 1190322-59-8

3-Bromo-1H-pyrrolo[2,3-b]pyridin-4-amine

Description:

3-Bromo-1H-pyrrolo[2,3-b]pyridin-4-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. The presence of a bromine atom at the 3-position and an amino group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure allows for various interactions, making it a candidate for research in drug development, particularly in targeting specific biological pathways. The bromine substituent can facilitate further chemical modifications, enhancing its utility in synthetic chemistry. Additionally, the compound may exhibit interesting biological activities, which are often explored in the context of pharmacological studies. As with many heterocycles, its properties can be influenced by the presence of functional groups, making it a versatile compound in organic synthesis and medicinal applications.

Formula: C₇H₆BrN₃

InChI: InChI=1S/C7H6BrN3/c8-4-3-11-7-6(4)5(9)1-2-10-7/h1-3H,(H3,9,10,11)

InChI key: InChIKey=FLCYLEYQRVGIDA-UHFFFAOYSA-N

SMILES: NC1=C2C(=NC=C1)NC=C2Br

Synonyms:

• 3-Bromo-1H-pyrrolo[2,3-b]pyridin-4-amine
• 1H-Pyrrolo[2,3-b]pyridin-4-amine, 3-bromo-
• 4-AMino-3-broMo-7-azaindole

1H-Pyrrolo[2,3-b]pyridin-4-amine, 3-bromo-

CAS: 1190322-59-8

Formula: C₇H₆BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 212.0466

Ref: IN-DA000I1I

3-bromo-1H-pyrrolo[2,3-b]pyridin-4-amine

CAS: 1190322-59-8

Formula: C₇H₆BrN₃

Purity: 97%

Molecular weight: 212.05

Ref: 10-F517114