CAS 1190322-61-2
:3-Azetidinamine, N,N-diethyl-, hydrochloride (1:1)
Description:
3-Azetidinamine, N,N-diethyl-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the N,N-diethyl substituents indicates that two ethyl groups are attached to the nitrogen atom of the azetidine ring, enhancing its basicity and solubility in polar solvents. As a hydrochloride salt, it is typically encountered in a crystalline form, which improves its stability and handling properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its hydrochloride form suggests that it can be used in various applications, including drug formulation and synthesis. The compound's properties, such as melting point, solubility, and reactivity, can vary based on its specific interactions with other substances and environmental conditions. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, making it a versatile building block in organic synthesis.
Formula:C7H16N2·ClH
InChI:InChI=1S/C7H16N2.ClH/c1-3-9(4-2)7-5-8-6-7;/h7-8H,3-6H2,1-2H3;1H
InChI key:InChIKey=NFZYOEKWNCKEMX-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1CNC1.Cl
Synonyms:- 3-Azetidinamine, N,N-diethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
