CymitQuimica logo

CAS 1190322-62-3

:

Methyl 3-amino-1H-pyrrolo[2,3-b]pyridine-5-carboxylate

Description:
Methyl 3-amino-1H-pyrrolo[2,3-b]pyridine-5-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. This compound features an amino group and a carboxylate ester, contributing to its potential reactivity and biological activity. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various applications in medicinal chemistry and drug development. The compound's unique structure may exhibit interesting pharmacological properties, including potential activity as an enzyme inhibitor or in other therapeutic areas. Its molecular interactions are influenced by the functional groups present, which can participate in hydrogen bonding and other intermolecular forces. As with many heterocycles, the compound may also display distinct electronic properties due to the conjugated system of the aromatic rings. Overall, Methyl 3-amino-1H-pyrrolo[2,3-b]pyridine-5-carboxylate is of interest for further research in synthetic chemistry and pharmacology.
Formula:C9H9N3O2
InChI:InChI=1S/C9H9N3O2/c1-14-9(13)5-2-6-7(10)4-12-8(6)11-3-5/h2-4H,10H2,1H3,(H,11,12)
InChI key:InChIKey=PVKVCMWWGJUDGH-UHFFFAOYSA-N
SMILES:NC=1C=2C(=NC=C(C(OC)=O)C2)NC1
Synonyms:
  • Methyl 3-amino-1H-pyrrolo[2,3-b]pyridine-5-carboxylate
  • 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 3-amino-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.