CymitQuimica logo

CAS 1190322-63-4

:

4-Azido-3-iodo-1H-pyrrolo[2,3-b]pyridine

Description:
4-Azido-3-iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by the presence of both an azido group (-N3) and an iodo substituent on a pyrrolo[2,3-b]pyridine framework. This compound features a fused bicyclic structure, which contributes to its unique chemical properties and potential reactivity. The azido group is known for its ability to participate in various chemical reactions, including click chemistry, making this compound of interest in synthetic organic chemistry and materials science. The iodine atom introduces a halogen that can enhance the compound's reactivity, particularly in nucleophilic substitution reactions. Additionally, the presence of nitrogen atoms in the structure may impart basicity and influence the compound's solubility in different solvents. Overall, 4-Azido-3-iodo-1H-pyrrolo[2,3-b]pyridine is a versatile compound with potential applications in drug discovery, chemical biology, and the development of novel materials.
Formula:C7H4IN5
InChI:InChI=1S/C7H4IN5/c8-4-3-11-7-6(4)5(12-13-9)1-2-10-7/h1-3H,(H,10,11)
InChI key:InChIKey=PFYZRXFGICUPEJ-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C1=C2C(NC=C2I)=NC=C1
Synonyms:
  • 4-Azido-3-iodo-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 4-azido-3-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.