CAS 1190322-64-5

Piperazine, 1-(3-azetidinyl)-4-methyl-, hydrochloride (1:1)

Description:

Piperazine, 1-(3-azetidinyl)-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core structure, which is a six-membered ring containing two nitrogen atoms. The presence of a 3-azetidinyl group and a methyl substituent at the 4-position contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit various pharmacological activities, potentially including effects on the central nervous system, given the structural similarities to other piperazine derivatives known for such activities. Its molecular structure suggests potential interactions with neurotransmitter systems, although specific biological effects would depend on further empirical studies. Safety and handling considerations are essential, as with many chemical substances, particularly those with potential pharmacological effects. Proper storage conditions and adherence to safety protocols are necessary to ensure stability and minimize risks associated with exposure.

Formula: C₈H₁₇N₃·ClH

InChI: InChI=1S/C8H17N3.ClH/c1-10-2-4-11(5-3-10)8-6-9-7-8;/h8-9H,2-7H2,1H3;1H

InChI key: InChIKey=NIHKJHVKRCVMHY-UHFFFAOYSA-N

SMILES: CN1CCN(C2CNC2)CC1.Cl

Synonyms:

• Piperazine, 1-(3-azetidinyl)-4-methyl-, hydrochloride (1:1)