
CAS 1190322-71-4
:3-Bromo-4-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
Description:
3-Bromo-4-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and pyridine moiety. The presence of a bromine atom at the 3-position and a methyl group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound features a hydroxyl group (-OH) at the 5-position, which can participate in hydrogen bonding and influence its solubility and biological activity. The molecular structure suggests that it may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity. Overall, 3-Bromo-4-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol represents a valuable compound in the field of organic chemistry and drug discovery.
Formula:C8H7BrN2O
InChI:InChI=1S/C8H7BrN2O/c1-4-6(12)3-11-8-7(4)5(9)2-10-8/h2-3,12H,1H3,(H,10,11)
InChI key:InChIKey=ZFXZYUHKUAUDTI-UHFFFAOYSA-N
SMILES:CC1=C2C(=NC=C1O)NC=C2Br
Synonyms:- 3-Bromo-4-methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
- 1H-Pyrrolo[2,3-b]pyridin-5-ol, 3-bromo-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
