CAS 1190322-72-5

6-Fluoro-4-nitrobenzothiazole

Description:

6-Fluoro-4-nitrobenzothiazole is a heterocyclic organic compound characterized by the presence of both a fluorine atom and a nitro group attached to a benzothiazole ring system. The benzothiazole moiety consists of a benzene ring fused to a thiazole ring, which contains sulfur and nitrogen. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and materials science, particularly due to the reactivity of the nitro and fluoro substituents. The presence of the nitro group can enhance the compound's electrophilic properties, making it useful in various chemical reactions. Additionally, the fluorine atom can influence the compound's lipophilicity and biological activity. As with many nitrogen-containing heterocycles, 6-Fluoro-4-nitrobenzothiazole may exhibit interesting pharmacological properties, warranting further investigation in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₇H₃FN₂O₂S

InChI: InChI=1S/C7H3FN2O2S/c8-4-1-5(10(11)12)7-6(2-4)13-3-9-7/h1-3H

InChI key: InChIKey=HMOWMGMVUXEQAH-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(=CC(F)=C1)SC=N2

Synonyms:

• Benzothiazole, 6-fluoro-4-nitro-
• 6-Fluoro-4-nitrobenzothiazole

Benzothiazole, 6-fluoro-4-nitro-

CAS: 1190322-72-5

Formula: C₇H₃FN₂O₂S

Molecular weight: 198.1743

Ref: IN-DA000I2L