
CAS 1190322-74-7
:5-Methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine
Description:
5-Methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its pyrrole and pyridine rings fused together, which contributes to its unique chemical properties. The presence of a methoxy group (-OCH3) and a methyl group (-CH3) on the pyrrolo structure enhances its solubility and reactivity. This compound is typically studied for its potential biological activities, including its role in medicinal chemistry and as a scaffold for drug development. Its molecular structure suggests that it may exhibit interesting electronic properties due to the conjugation between the aromatic systems. Additionally, the compound's stability and reactivity can be influenced by the substituents on the ring, making it a subject of interest in synthetic organic chemistry. As with many heterocycles, it may also participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, depending on the reaction conditions. Overall, 5-Methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine represents a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-6-7-3-4-10-9(7)11-5-8(6)12-2/h3-5H,1-2H3,(H,10,11)
InChI key:InChIKey=SPIAREYCIANVCP-UHFFFAOYSA-N
SMILES:CC1=C2C(=NC=C1OC)NC=C2
Synonyms:- 5-Methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 5-methoxy-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
