
CAS 1190322-75-8
:1H-Pyrrolo[2,3-b]pyridine-3,5-diamine
Description:
1H-Pyrrolo[2,3-b]pyridine-3,5-diamine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two amino groups at the 3 and 5 positions of the pyrrolo-pyridine structure, enhancing its potential for hydrogen bonding and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino groups. The compound is of interest in medicinal chemistry, particularly for its potential biological activities, including anti-cancer and anti-inflammatory properties. Its molecular structure allows for various modifications, which can lead to derivatives with enhanced pharmacological profiles. Additionally, the presence of nitrogen atoms in the ring system can influence its electronic properties, making it a candidate for applications in organic electronics and as a ligand in coordination chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H8N4
InChI:InChI=1S/C7H8N4/c8-4-1-5-6(9)3-11-7(5)10-2-4/h1-3H,8-9H2,(H,10,11)
InChI key:InChIKey=QTMGJSFQZZIFCT-UHFFFAOYSA-N
SMILES:NC=1C=2C(=NC=C(N)C2)NC1
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine-3,5-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
