
CAS 1190322-76-9
:3-Iodo-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine
Description:
3-Iodo-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both nitrogen and carbon atoms in a fused ring system. The presence of an iodine atom at the 3-position and a methoxy group at the 5-position contributes to its reactivity and potential biological activity. The methyl group at the 4-position can influence the compound's lipophilicity and solubility. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of halogen and methoxy substituents can enhance its interaction with biological targets, potentially leading to novel therapeutic agents. As with many heterocycles, the compound's stability, reactivity, and interactions with other molecules are influenced by its electronic and steric properties, which are critical for understanding its behavior in various chemical environments.
Formula:C9H9IN2O
InChI:InChI=1S/C9H9IN2O/c1-5-7(13-2)4-12-9-8(5)6(10)3-11-9/h3-4H,1-2H3,(H,11,12)
InChI key:InChIKey=PSLPYYVDLXFZBW-UHFFFAOYSA-N
SMILES:CC1=C2C(=NC=C1OC)NC=C2I
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 3-iodo-5-methoxy-4-methyl-
- 3-Iodo-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
