CymitQuimica logo

CAS 1190322-79-2

:

5-Methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:
5-Methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a pyrrole and a pyridine ring. This compound features a methoxy group and a methyl group, contributing to its unique chemical properties and potential biological activity. The presence of the carboxylic acid functional group suggests it may exhibit acidic behavior and participate in various chemical reactions, such as esterification or amidation. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity can be influenced by the substituents on the rings, which may also affect its pharmacokinetic properties. As with many heterocycles, it may exhibit interesting electronic properties due to the conjugation within the ring system. Overall, 5-Methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid represents a class of compounds that could be valuable in research and therapeutic applications.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-5-7(15-2)4-12-9-8(5)6(3-11-9)10(13)14/h3-4H,1-2H3,(H,11,12)(H,13,14)
InChI key:InChIKey=MVZOYDQTWOULSY-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=NC=C(OC)C2C
Synonyms:
  • 5-Methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid
  • 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 5-methoxy-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.