CymitQuimica logo

CAS 1190322-84-9

:

3-Chloro-6-fluoro-1H-pyrrolo[2,3-b]pyridine

Description:
3-Chloro-6-fluoro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of chlorine and fluorine substituents at specific positions on the aromatic system enhances its reactivity and potential biological activity. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms, influencing its solubility in various solvents. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-withdrawing nature of the halogens. Additionally, its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's stability and reactivity can be further influenced by the presence of functional groups and the overall electronic environment of the molecule. As with many heterocycles, it may also exhibit interesting optical and electronic properties, making it a subject of interest in materials science and drug discovery.
Formula:C7H4ClFN2
InChI:InChI=1S/C7H4ClFN2/c8-5-3-10-7-4(5)1-2-6(9)11-7/h1-3H,(H,10,11)
InChI key:InChIKey=XFIYBNNMQGYYTG-UHFFFAOYSA-N
SMILES:ClC=1C=2C(NC1)=NC(F)=CC2
Synonyms:
  • 3-Chloro-6-fluoro-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 3-chloro-6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.