
CAS 1190322-88-3
:Methyl 3-iodo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate
Description:
Methyl 3-iodo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which features a fused pyrrole and pyridine ring system. The presence of an iodine atom at the 3-position and a carboxylate ester group at the 6-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential for various chemical transformations, making it of interest in the synthesis of biologically active molecules. The iodine substituent can facilitate nucleophilic substitution reactions, while the carboxylate group can participate in esterification or coupling reactions. Overall, Methyl 3-iodo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate is a valuable compound for research in organic synthesis and drug development, particularly in the exploration of new therapeutic agents.
Formula:C9H7IN2O2
InChI:InChI=1S/C9H7IN2O2/c1-14-9(13)5-2-7-8(12-3-5)6(10)4-11-7/h2-4,11H,1H3
InChI key:InChIKey=NLWUOXQLRUYOQW-UHFFFAOYSA-N
SMILES:IC=1C=2C(=CC(C(OC)=O)=CN2)NC1
Synonyms:- Methyl 3-iodo-1H-pyrrolo[3,2-b]pyridine-6-carboxylate
- 1H-Pyrrolo[3,2-b]pyridine-6-carboxylic acid, 3-iodo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrrolo[3,2-b]pyridine-6-carboxylic acid, 3-iodo-, methyl ester
CAS:Formula:C9H7IN2O2Molecular weight:302.0686
