CAS 1190322-89-4
:4-Fluoro-1H-pyrrolo[2,3-b]pyridin-6-amine
Description:
4-Fluoro-1H-pyrrolo[2,3-b]pyridin-6-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine ring fused together. The presence of a fluorine atom at the 4-position of the pyrrole ring and an amino group at the 6-position of the pyridine ring contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their roles as kinase inhibitors and in other therapeutic areas. Additionally, the fluorine substitution can enhance lipophilicity and metabolic stability, making it a valuable candidate for drug design. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions.
Formula:C7H6FN3
InChI:InChI=1S/C7H6FN3/c8-5-3-6(9)11-7-4(5)1-2-10-7/h1-3H,(H3,9,10,11)
InChI key:InChIKey=WYAKZOQASHGXRG-UHFFFAOYSA-N
SMILES:FC1=C2C(=NC(N)=C1)NC=C2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridin-6-amine, 4-fluoro-
- 4-Fluoro-1H-pyrrolo[2,3-b]pyridin-6-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
