CymitQuimica logo

CAS 1190322-91-8

:

4-Chloro-6-fluoro-1H-pyrrolo[2,3-b]pyridine

Description:
4-Chloro-6-fluoro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of chlorine and fluorine substituents enhances its reactivity and potential biological activity. This compound typically exhibits a pale yellow to off-white solid appearance and is soluble in organic solvents, making it suitable for various applications in medicinal chemistry and material science. Its molecular structure allows for potential interactions with biological targets, which may lead to pharmacological effects. The compound's CAS number, 1190322-91-8, is a unique identifier that facilitates its identification in chemical databases. Additionally, its synthesis and characterization are of interest in research contexts, particularly in the development of new pharmaceuticals or agrochemicals. Overall, 4-Chloro-6-fluoro-1H-pyrrolo[2,3-b]pyridine represents a valuable compound in the field of organic chemistry, with implications for further studies and applications.
Formula:C7H4ClFN2
InChI:InChI=1S/C7H4ClFN2/c8-5-3-6(9)11-7-4(5)1-2-10-7/h1-3H,(H,10,11)
InChI key:InChIKey=BMWHZCNXNOAJNU-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(F)=C1)NC=C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-6-fluoro-
  • 4-Chloro-6-fluoro-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.