CAS 1190322-94-1

3-Bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid

Description:

3-Bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. The presence of a bromine atom at the 3-position of the pyrrole ring contributes to its reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 6-position enhances its solubility in polar solvents and allows for potential derivatization, making it a versatile building block in organic synthesis. This compound may exhibit biological activity, which is often explored in drug discovery and development. Its molecular structure suggests potential interactions with biological targets, making it of interest in pharmacological research. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 3-Bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid represents a significant compound in the field of organic and medicinal chemistry.

Formula: C₈H₅BrN₂O₂

InChI: InChI=1S/C8H5BrN2O2/c9-5-3-10-6-1-4(8(12)13)2-11-7(5)6/h1-3,10H,(H,12,13)

InChI key: InChIKey=RCBLXFNIIXVNOD-UHFFFAOYSA-N

SMILES: BrC=1C=2C(=CC(C(O)=O)=CN2)NC1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-6-carboxylic acid, 3-bromo-
• 3-Bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid
• 3-BroMo-4-azaindole-6-carboxylic acid

1H-Pyrrolo[3,2-b]pyridine-6-carboxylic acid, 3-bromo-

CAS: 1190322-94-1

Formula: C₈H₅BrN₂O₂

Purity: 98%

Molecular weight: 241.0415

Ref: IN-DA000I34

3-Bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid

CAS: 1190322-94-1

3-Bromo-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid

Purity: 98%

Molecular weight: 241.04g/mol

Ref: 54-OR1061933