CAS 1190322-97-4

6-Bromo-4-iodo-1H-pyrrolo[2,3-b]pyridine

Description:

6-Bromo-4-iodo-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and iodine substituents at the 6 and 4 positions, respectively, enhances its reactivity and potential for further chemical modifications. This compound typically exhibits a planar structure, which can facilitate π-π stacking interactions, making it of interest in materials science and organic electronics. Its halogenated nature may also impart interesting biological activities, making it a candidate for pharmaceutical research. The compound is likely to be soluble in organic solvents, and its reactivity can be influenced by the electron-withdrawing effects of the halogens. Additionally, the presence of multiple heteroatoms can affect its electronic properties, making it a subject of study in various fields, including medicinal chemistry and organic synthesis. Overall, 6-Bromo-4-iodo-1H-pyrrolo[2,3-b]pyridine is a versatile compound with potential applications in both research and industry.

Formula: C₇H₄BrIN₂

InChI: InChI=1S/C7H4BrIN2/c8-6-3-5(9)4-1-2-10-7(4)11-6/h1-3H,(H,10,11)

InChI key: InChIKey=AQWBBVKZYHPPET-UHFFFAOYSA-N

SMILES: IC1=C2C(=NC(Br)=C1)NC=C2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 6-bromo-4-iodo-
• 6-Bromo-4-iodo-1H-pyrrolo[2,3-b]pyridine

1H-Pyrrolo[2,3-b]pyridine, 6-bromo-4-iodo-

CAS: 1190322-97-4

Formula: C₇H₄BrIN₂

Molecular weight: 322.9285

Ref: IN-DA000I32