
CAS 1190372-41-8
:rel-4-[2-[2-[(1R,2S,5R)-6,6-Dimethylbicyclo[3.1.1]hept-2-yl]ethoxy]ethyl]morpholine
Description:
Rel-4-[2-[2-[(1R,2S,5R)-6,6-Dimethylbicyclo[3.1.1]hept-2-yl]ethoxy]ethyl]morpholine, with the CAS number 1190372-41-8, is a chemical compound characterized by its complex bicyclic structure and morpholine moiety. This substance features a bicyclo[3.1.1]heptane core, which contributes to its unique three-dimensional shape and steric properties. The presence of the morpholine ring adds to its potential for biological activity, as morpholines are often found in pharmaceuticals due to their ability to interact with various biological targets. The ethoxy and ethyl substituents enhance its solubility and may influence its pharmacokinetic properties. The stereochemistry indicated by the (1R,2S,5R) configuration suggests specific spatial arrangements that can affect the compound's interactions with biological systems. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. Further studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C17H31NO2
InChI:InChI=1/C17H31NO2/c1-17(2)15-4-3-14(16(17)13-15)5-9-19-10-6-18-7-11-20-12-8-18/h14-16H,3-13H2,1-2H3/t14-,15+,16+/s2
InChI key:InChIKey=FPLHEALBGYMFJM-RPCVLTJTNA-N
SMILES:C(COCCN1CCOCC1)[C@H]2[C@@]3(C(C)(C)[C@@](C3)(CC2)[H])[H]
Synonyms:- Morpholine, 4-[2-[2-[(1R,2S,5R)-6,6-dimethylbicyclo[3.1.1]hept-2-yl]ethoxy]ethyl]-, rel-
- rel-4-[2-[2-[(1R,2S,5R)-6,6-Dimethylbicyclo[3.1.1]hept-2-yl]ethoxy]ethyl]morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
