
CAS 1190391-81-1
:2-[[(1,1-Dimethylethoxy)carbonyl]amino]-5,6-dihydro-4H-cyclopentathiazole-4-carboxylic acid
Description:
2-[[(1,1-Dimethylethoxy)carbonyl]amino]-5,6-dihydro-4H-cyclopentathiazole-4-carboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclopentathiazole ring, an amino group, and a carboxylic acid functional group. This compound features a dimethylethoxycarbonyl substituent, which contributes to its reactivity and solubility properties. The presence of the thiazole ring indicates potential biological activity, as thiazole derivatives are often found in pharmaceuticals. The compound's carboxylic acid group can participate in various chemical reactions, including esterification and amidation, making it versatile for synthetic applications. Additionally, the compound's molecular structure suggests it may exhibit specific interactions with biological targets, potentially leading to applications in medicinal chemistry. Its CAS number, 1190391-81-1, allows for easy identification and reference in chemical databases. Overall, this compound's unique features make it of interest in both research and industrial contexts, particularly in the development of new therapeutic agents.
Formula:C12H16N2O4S
InChI:InChI=1S/C12H16N2O4S/c1-12(2,3)18-11(17)14-10-13-8-6(9(15)16)4-5-7(8)19-10/h6H,4-5H2,1-3H3,(H,15,16)(H,13,14,17)
InChI key:InChIKey=KCDYGQQYGFBDTN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C2=C(SC(NC(OC(C)(C)C)=O)=N2)CC1
Synonyms:- 2-[[(1,1-Dimethylethoxy)carbonyl]amino]-5,6-dihydro-4H-cyclopentathiazole-4-carboxylic acid
- 2-[[(tert-Butoxy)carbonyl]amino]-4H,5H,6H-cyclopenta[d][1,3]thiazole-4-carboxylic acid
- 4H-Cyclopentathiazole-4-carboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-5,6-dihydro-
- 2-((tert-Butoxycarbonyl)amino)-5,6-dihydro-4H-cyclopenta[d]thiazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.