
CAS 1190392-05-2
:Ethyl 6,7-dihydro-3-methyl-5H-pyrrolo[2,1-c]-1,2,4-triazole-7-carboxylate
Description:
Ethyl 6,7-dihydro-3-methyl-5H-pyrrolo[2,1-c]-1,2,4-triazole-7-carboxylate is a heterocyclic compound characterized by its unique pyrrolo-triazole structure. This compound features a fused ring system that includes both a pyrrole and a triazole moiety, contributing to its potential biological activity. The presence of the ethyl ester functional group enhances its solubility and reactivity, making it suitable for various chemical reactions. Typically, compounds of this nature may exhibit interesting pharmacological properties, including antimicrobial or anti-inflammatory activities, although specific biological data would need to be referenced for precise applications. The molecular structure suggests potential for interactions with biological targets, which is often explored in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the substituents on the ring system, making it a candidate for further research in drug development or synthetic chemistry. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C9H13N3O2
InChI:InChI=1S/C9H13N3O2/c1-3-14-9(13)7-4-5-12-6(2)10-11-8(7)12/h7H,3-5H2,1-2H3
InChI key:InChIKey=XPCNGGZROZCNFF-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1C=2N(CC1)C(C)=NN2
Synonyms:- Ethyl 6,7-dihydro-3-methyl-5H-pyrrolo[2,1-c]-1,2,4-triazole-7-carboxylate
- 5H-Pyrrolo[2,1-c]-1,2,4-triazole-7-carboxylic acid, 6,7-dihydro-3-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.