CymitQuimica logo

CAS 1190392-23-4

:

Methyl (6S)-4,6,7,8-tetrahydro-4-oxopyrrolo[1,2-a]pyrimidine-6-carboxylate

Description:
Methyl (6S)-4,6,7,8-tetrahydro-4-oxopyrrolo[1,2-a]pyrimidine-6-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolopyrimidine framework. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a carboxylate functional group, which contributes to its reactivity and potential biological activity. The methyl ester group enhances its solubility and may influence its pharmacokinetic properties. The stereochemistry at the 6-position, denoted as (6S), suggests specific spatial arrangements that can affect the compound's interactions with biological targets. Such compounds are often of interest in medicinal chemistry due to their potential as drug candidates, particularly in the development of therapeutics targeting various diseases. The presence of the oxo group indicates potential for hydrogen bonding and reactivity, which can be crucial in biological systems. Overall, this compound's unique structural features may confer specific properties that are valuable in research and pharmaceutical applications.
Formula:C9H10N2O3
InChI:InChI=1S/C9H10N2O3/c1-14-9(13)6-2-3-7-10-5-4-8(12)11(6)7/h4-6H,2-3H2,1H3/t6-/m0/s1
InChI key:InChIKey=FQHDVSMSHVCUIP-LURJTMIESA-N
SMILES:C(OC)(=O)[C@H]1N2C(CC1)=NC=CC2=O
Synonyms:
  • Pyrrolo[1,2-a]pyrimidine-6-carboxylic acid, 4,6,7,8-tetrahydro-4-oxo-, methyl ester, (6S)-
  • Methyl (6S)-4,6,7,8-tetrahydro-4-oxopyrrolo[1,2-a]pyrimidine-6-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.