CAS 1190392-36-9

Methyl 4-methoxy-5-pyrimidineacetate

Description:

Methyl 4-methoxy-5-pyrimidineacetate is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methoxy group (-OCH3) at the 4-position and an acetate group (-COOCH3) at the 5-position of the pyrimidine ring, contributing to its reactivity and solubility properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the methoxy and acetate functional groups enhances its potential for various chemical reactions, including esterification and nucleophilic substitutions. Methyl 4-methoxy-5-pyrimidineacetate may be utilized in pharmaceutical synthesis, agrochemical formulations, or as an intermediate in organic synthesis. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would depend on the conditions and purity of the substance. Safety data should be consulted for handling and storage guidelines, as with any chemical compound.

Formula: C₈H₁₀N₂O₃

InChI: InChI=1S/C8H10N2O3/c1-12-7(11)3-6-4-9-5-10-8(6)13-2/h4-5H,3H2,1-2H3

InChI key: InChIKey=SUVDRORBKXXSSJ-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C=1C(OC)=NC=NC1

Synonyms:

• 5-Pyrimidineacetic acid, 4-methoxy-, methyl ester
• Methyl 4-methoxy-5-pyrimidineacetate