CAS 1190392-37-0

4-Methoxy-α-methyl-5-pyrimidineacetic acid

Description:

4-Methoxy-α-methyl-5-pyrimidineacetic acid is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methoxy group (-OCH3) at the 4-position and an α-methyl group adjacent to the carboxylic acid functional group, contributing to its unique properties. The presence of the carboxylic acid group (-COOH) indicates that it can act as an acid, capable of donating protons in solution. The methoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. This compound may be of interest in pharmaceutical research due to its potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Its molecular structure suggests that it could exhibit various interactions with biological macromolecules, making it a candidate for further investigation in drug design and development.

Formula: C₈H₁₀N₂O₃

InChI: InChI=1S/C8H10N2O3/c1-5(8(11)12)6-3-9-4-10-7(6)13-2/h3-5H,1-2H3,(H,11,12)

InChI key: InChIKey=ZFZSPHNOKGEWKQ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C)C=1C(OC)=NC=NC1

Synonyms:

• 5-Pyrimidineacetic acid, 4-methoxy-α-methyl-
• 4-Methoxy-α-methyl-5-pyrimidineacetic acid
• 2-(4-Methoxypyrimidin-5-yl)propanoic acid