
CAS 1190392-49-4
:Methyl 6,7-dihydro-5H-cyclopenta[b]pyridine-7-carboxylate
Description:
Methyl 6,7-dihydro-5H-cyclopenta[b]pyridine-7-carboxylate is a chemical compound characterized by its bicyclic structure, which incorporates both a pyridine and a cyclopentane moiety. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. Its unique structure may impart specific biological activities, which could be of interest in medicinal chemistry. The compound's molecular framework suggests potential for interactions with biological targets, although detailed studies would be necessary to elucidate its pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, Methyl 6,7-dihydro-5H-cyclopenta[b]pyridine-7-carboxylate represents a versatile building block in synthetic organic chemistry, with potential implications in drug development and material science.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-13-10(12)8-5-4-7-3-2-6-11-9(7)8/h2-3,6,8H,4-5H2,1H3
InChI key:InChIKey=CHTQOIXSFGYLQP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C=2C(CC1)=CC=CN2
Synonyms:- Methyl 6,7-dihydro-5H-cyclopenta[b]pyridine-7-carboxylate
- 5H-Cyclopenta[b]pyridine-7-carboxylic acid, 6,7-dihydro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.