CAS 1190392-67-6

Methyl dihydro-2-oxo-2H-1,3-oxazine-3(4H)-acetate

Description:

Methyl dihydro-2-oxo-2H-1,3-oxazine-3(4H)-acetate, identified by its CAS number 1190392-67-6, is a chemical compound characterized by its oxazine ring structure, which contributes to its unique reactivity and properties. This substance typically exhibits a polar nature due to the presence of functional groups such as the acetate moiety and the carbonyl group within the oxazine ring. It may participate in various chemical reactions, including nucleophilic attacks and cyclization processes, making it of interest in synthetic organic chemistry. The compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, its stability and solubility in organic solvents can influence its behavior in different chemical environments. As with many chemical substances, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity. Further studies would be necessary to fully elucidate its properties and applications in various fields.

Formula: C₇H₁₁NO₄

InChI: InChI=1S/C7H11NO4/c1-11-6(9)5-8-3-2-4-12-7(8)10/h2-5H2,1H3

InChI key: InChIKey=WEFMNLIWBBCCGO-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1C(=O)OCCC1

Synonyms:

• 2H-1,3-Oxazine-3(4H)-acetic acid, dihydro-2-oxo-, methyl ester
• Methyl dihydro-2-oxo-2H-1,3-oxazine-3(4H)-acetate