CymitQuimica logo

CAS 1190392-81-4

:

α-Methyl-4-thiazoleacetic acid

Description:
α-Methyl-4-thiazoleacetic acid is an organic compound characterized by its thiazole ring, which contributes to its unique chemical properties. This compound features a methyl group attached to the alpha position of the thiazole, along with an acetic acid functional group, making it a carboxylic acid derivative. The presence of the thiazole ring imparts heterocyclic characteristics, influencing its reactivity and potential biological activity. Typically, compounds like α-Methyl-4-thiazoleacetic acid are studied for their roles in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound may exhibit polar characteristics due to the carboxylic acid group, which can engage in hydrogen bonding, affecting its solubility in various solvents. Additionally, the thiazole moiety can participate in various chemical reactions, such as nucleophilic substitutions or cyclization processes. Overall, α-Methyl-4-thiazoleacetic acid is a compound of interest in both synthetic and medicinal chemistry, with potential applications that warrant further investigation.
Formula:C6H7NO2S
InChI:InChI=1S/C6H7NO2S/c1-4(6(8)9)5-2-10-3-7-5/h2-4H,1H3,(H,8,9)
InChI key:InChIKey=FMZBIKUWVVQHQJ-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)C1=CSC=N1
Synonyms:
  • 2-(1,3-Thiazol-4-yl)propanoic acid
  • α-Methyl-4-thiazoleacetic acid
  • 4-Thiazoleacetic acid, α-methyl-
  • 2-(Thiazol-4-yl)propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.