CymitQuimica logo

CAS 1190423-36-9

:

2-(N,N-BisBOC-Amino)pyrimidine-5-boronic acid, pinacol ester

Description:
2-(N,N-BisBOC-Amino)pyrimidine-5-boronic acid, pinacol ester, is a chemical compound characterized by its boronic acid functionality, which is often utilized in Suzuki coupling reactions for the formation of carbon-carbon bonds. The presence of the BOC (tert-butyloxycarbonyl) protecting groups on the amino functionalities indicates that this compound is likely used in synthetic organic chemistry, particularly in the preparation of more complex molecules. The pyrimidine ring contributes to its aromatic character and may influence its reactivity and solubility. The pinacol ester moiety enhances the stability of the boronic acid, making it more suitable for various applications, including medicinal chemistry and materials science. This compound is typically handled under inert atmospheres to prevent hydrolysis and degradation. Its specific applications may include drug development, where the boronic acid can participate in biological interactions, or in the synthesis of polymers and other advanced materials. Overall, its unique structural features make it a valuable intermediate in organic synthesis.
Formula:C20H32BN3O6
InChI:InChI=1S/C20H32BN3O6/c1-17(2,3)27-15(25)24(16(26)28-18(4,5)6)14-22-11-13(12-23-14)21-29-19(7,8)20(9,10)30-21/h11-12H,1-10H3
InChI key:SJJXYKAZGIJVQP-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C
Found 5 products.