CymitQuimica logo

CAS 119043-16-2

:

4-[2-[[(3-Ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]benzenesulfonyl chloride

Description:
4-[2-[[(3-Ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]benzenesulfonyl chloride, with CAS number 119043-16-2, is a chemical compound characterized by its complex structure, which includes a sulfonyl chloride functional group. This compound features a sulfonamide linkage, indicating potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the pyrrole ring suggests that it may exhibit unique biological activities, as pyrrole derivatives are often associated with various pharmacological properties. The sulfonyl chloride group is reactive, making it useful for further chemical modifications or as a reagent in organic synthesis. Additionally, the compound's molecular structure implies a degree of lipophilicity, which may influence its solubility and bioavailability. Overall, this compound's intricate architecture and functional groups position it as a potentially valuable entity in drug discovery and development, warranting further investigation into its chemical behavior and biological effects.
Formula:C16H19ClN2O4S
InChI:InChI=1S/C16H19ClN2O4S/c1-3-14-11(2)10-19(15(14)20)16(21)18-9-8-12-4-6-13(7-5-12)24(17,22)23/h4-7H,3,8-10H2,1-2H3,(H,18,21)
InChI key:InChIKey=KEFLFSMLSAEGQB-UHFFFAOYSA-N
SMILES:C(NCCC1=CC=C(S(Cl)(=O)=O)C=C1)(=O)N2C(=O)C(CC)=C(C)C2
Synonyms:
  • 4-[2-[(4-ethyl-3-methyl-5-oxo-2H-pyrrole-1-carbonyl)amino]ethyl]benzenesulfonyl chloride
  • Benzenesulfonyl chloride, 4-[2-[[(3-ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]-
  • Glmn-B
  • 4-[2-[[(3-Ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl]amino]ethyl]benzenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.