CAS 119047-14-2
:2-CHLORO-4-NITROPHENYL-ALPHA-D-GLUCOPYRANOSIDE
Description:
2-Chloro-4-nitrophenyl-alpha-D-glucopyranoside is a chemical compound characterized by its structure, which includes a glucopyranoside moiety linked to a 2-chloro-4-nitrophenyl group. This compound is typically used in biochemical applications, particularly as a substrate in enzyme assays, due to its ability to undergo hydrolysis by glycosidases. The presence of the chloro and nitro substituents on the phenyl ring influences its reactivity and solubility properties, making it a useful tool in studying enzyme kinetics and mechanisms. The alpha configuration indicates that the hydroxyl group at the anomeric carbon is oriented in a specific manner, which is crucial for its interaction with enzymes. Additionally, the compound's molecular structure contributes to its stability and potential applications in synthetic organic chemistry. Safety data sheets should be consulted for handling and storage guidelines, as the presence of chlorine and nitro groups may impart certain hazards. Overall, 2-chloro-4-nitrophenyl-alpha-D-glucopyranoside serves as an important compound in both research and industrial contexts.
Formula:C12H14ClNO8
InChI:InChI=1/C12H14ClNO8/c13-6-3-5(14(19)20)1-2-7(6)21-12-11(18)10(17)9(16)8(4-15)22-12/h1-3,8-12,15-18H,4H2/t8?,9-,10+,11+,12+/m1/s1
Synonyms:- 2-Chloro-4-nitrophenyl-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-4-nitrophenyl-α-D-glucopyranoside
CAS:Formula:C12H14ClNO8Purity:98.00%Color and Shape:SolidMolecular weight:335.69452-Chloro-4-nitrophenyl-α-D-glucopyranoside
CAS:2-Chloro-4-nitrophenyl-α-D-glucopyranoside (CNP-α-D-Glucopyraoside) is used for measuring α-glucosidase activity.Formula:C12H14ClNO8Color and Shape:SolidMolecular weight:335.692-Chloro-4-nitrophenyl α-D-glucopyranoside
CAS:2-Chloro-4-nitrophenyl α-D-glucopyranosidePurity:>98%Molecular weight:335.69g/mol2-Chloro-4-nitrophenyl a-D-glucopyranoside
CAS:2-Chloro-4-nitrophenyl a-D-glucopyranoside is an an enzyme-activated irreversible inhibitor of alpha-glucosidase. The substrate 2-Chloro-4-nitrophenyl a-D-glucopyranoside is covalently attached to the enzyme enabling mechanistic studies of glycosidase activity, especificallyt in carbohydrate metabolism studies.Purity:Max. 97 Area-%Color and Shape:White Off-White PowderMolecular weight:335.69 g/mol




