CymitQuimica logo

CAS 119052-84-5

:

β,3-Dimethylbenzenepropanol

Description:
β,3-Dimethylbenzenepropanol, also known by its CAS number 119052-84-5, is an organic compound characterized by its structure, which features a propanol group attached to a dimethyl-substituted benzene ring. This compound typically exhibits properties common to alcohols, such as being a colorless liquid with potential solubility in organic solvents. Its molecular structure suggests it may have moderate polarity due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its physical properties like boiling point and solubility. The presence of the dimethyl groups on the benzene ring can affect its reactivity and steric hindrance, potentially impacting its interactions in chemical reactions. β,3-Dimethylbenzenepropanol may find applications in various fields, including organic synthesis and as an intermediate in the production of other chemical compounds. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C11H16O
InChI:InChI=1S/C11H16O/c1-9-4-3-5-11(6-9)7-10(2)8-12/h3-6,10,12H,7-8H2,1-2H3
InChI key:InChIKey=JMCWASCQLXRRQD-UHFFFAOYSA-N
SMILES:C(C(CO)C)C1=CC(C)=CC=C1
Synonyms:
  • β,3-Dimethylbenzenepropanol
  • 2-Methyl-3-(3-methylphenyl)propan-1-ol
  • Benzenepropanol, β,3-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.