CAS 119065-82-6
:(1R,2R,3S,7S,7aR)-3-(hydroxymethyl)hexahydro-1H-pyrrolizine-1,2,7-triol
Description:
The chemical substance known as (1R,2R,3S,7S,7aR)-3-(hydroxymethyl)hexahydro-1H-pyrrolizine-1,2,7-triol, with the CAS number 119065-82-6, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a hexahydro-pyrrolizine core, which is a bicyclic structure that contributes to its rigidity and potential biological activity. The presence of hydroxymethyl and triol functional groups indicates that the molecule has multiple hydroxyl (-OH) groups, which can enhance its solubility in water and reactivity in various chemical reactions. The stereochemical configuration, denoted by the R and S designations, suggests that the compound may exhibit chirality, potentially leading to different biological interactions depending on its orientation. Such compounds are often of interest in medicinal chemistry and pharmacology due to their potential therapeutic effects. Overall, this substance's unique structure and functional groups make it a candidate for further investigation in various chemical and biological applications.
Formula:C8H15NO4
InChI:InChI=1/C8H15NO4/c10-3-4-7(12)8(13)6-5(11)1-2-9(4)6/h4-8,10-13H,1-3H2/t4-,5-,6+,7+,8+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1H-Pyrrolizine-1,2,7-triol, hexahydro-3-(hydroxymethyl)-, (1R,2R,3S,7S,7aR)-
CAS:Formula:C8H15NO4Molecular weight:189.2093,7a-Diepialexine
CAS:<p>3,7a-Diepialexine is an alkaloid, which is a naturally occurring compound typically derived from plant sources. It is often extracted from specific plant species known for their rich alkaloid content. The mode of action of 3,7a-Diepialexine involves interaction with biological receptors and enzymes, potentially modulating biochemical pathways and cellular processes. As with many alkaloids, this compound may exhibit a range of biological activities, possibly affecting neurotransmission, immunity, or cell growth.</p>Formula:C8H15NO4Purity:Min. 95%Molecular weight:189.21 g/mol

