CAS 119065-82-6: (1R,2R,3S,7S,7aR)-3-(hydroxymethyl)hexahydro-1H-pyrrolizine-1,2,7-triol

Description: The chemical substance known as (1R,2R,3S,7S,7aR)-3-(hydroxymethyl)hexahydro-1H-pyrrolizine-1,2,7-triol, with the CAS number 119065-82-6, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a hexahydro-pyrrolizine core, which is a bicyclic structure that contributes to its rigidity and potential biological activity. The presence of hydroxymethyl and triol functional groups indicates that the molecule has multiple hydroxyl (-OH) groups, which can enhance its solubility in water and reactivity in various chemical reactions. The stereochemical configuration, denoted by the R and S designations, suggests that the compound may exhibit chirality, potentially leading to different biological interactions depending on its orientation. Such compounds are often of interest in medicinal chemistry and pharmacology due to their potential therapeutic effects. Overall, this substance's unique structure and functional groups make it a candidate for further investigation in various chemical and biological applications.

Formula: C₈H₁₅NO₄

InChI: InChI=1/C8H15NO4/c10-3-4-7(12)8(13)6-5(11)1-2-9(4)6/h4-8,10-13H,1-3H2/t4-,5-,6+,7+,8+/m0/s1

1H-Pyrrolizine-1,2,7-triol, hexahydro-3-(hydroxymethyl)-, (1R,2R,3S,7S,7aR)-

CAS: 119065-82-6

• Formula: C₈H₁₅NO₄
• Molecular weight: 189.2090

3,7a-Diepialexine

CAS: 119065-82-6

3,7a-diepialexine is a natural product that can be found in plants. It has been shown …

• Formula: C₈H₁₅NO₄
• Purity: Min. 95%
• Molecular weight: 189.21 g/mol