CymitQuimica logo

CAS 119083-00-0

:

1-methyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

Description:
1-Methyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a methyl group at the 1-position and a trifluoromethyl group at the 5-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The carboxylic acid functional group at the 4-position enhances its acidity and solubility in polar solvents. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as a building block for the synthesis of biologically active molecules. Its trifluoromethyl group can also impart specific electronic properties, making it a valuable component in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the presence of the electron-withdrawing trifluoromethyl group, which may affect its interactions with biological targets. Overall, 1-methyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid exhibits a combination of structural features that make it a subject of interest in chemical research.
Formula:C6H5F3N2O2
InChI:InChI=1/C6H5F3N2O2/c1-11-4(6(7,8)9)3(2-10-11)5(12)13/h2H,1H3,(H,12,13)
InChI key:VAKOSNKAXYJZRG-UHFFFAOYSA-N
SMILES:Cn1c(c(cn1)C(=O)O)C(F)(F)F
Synonyms:
  • 1-methyl-5-trifluoromethyl-1h-pyrazole-4-carboxylic acid
Found 4 products.