CymitQuimica logo

CAS 119085-63-1

:

(2-FLUORO-4,5-DIMETHOXYPHENYL)-(R)-HYDROXYACETONITRILE

Description:
(2-Fluoro-4,5-dimethoxyphenyl)-(R)-hydroxyacetonitrile, with the CAS number 119085-63-1, is a chemical compound characterized by its specific functional groups and stereochemistry. It features a fluorinated aromatic ring, which contributes to its electronic properties and potential reactivity. The presence of methoxy groups enhances its solubility in organic solvents and may influence its biological activity. The (R)-hydroxyacetonitrile moiety indicates that the compound has a chiral center, which can affect its interaction with biological systems, making it of interest in pharmaceutical applications. This compound may exhibit unique properties such as specific binding affinities or reactivity patterns due to its structural features. Additionally, the presence of the nitrile group suggests potential for further chemical transformations, making it a versatile intermediate in organic synthesis. Overall, the combination of these characteristics positions (2-fluoro-4,5-dimethoxyphenyl)-(R)-hydroxyacetonitrile as a compound of interest in both research and potential therapeutic applications.
Formula:C10H10FNO3
InChI:InChI=1/C10H10FNO3/c1-14-9-3-6(8(13)5-12)7(11)4-10(9)15-2/h3-4,8,13H,1-2H3/t8-/m0/s1
SMILES:COc1cc(c(cc1OC)F)[C@H](C#N)O
Synonyms:
  • 2-Fluoro-α-hydroxy-4,5-dimethoxybenzeneacetonitrile
  • (2R)-(2-fluoro-4,5-dimethoxyphenyl)(hydroxy)ethanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.