CymitQuimica logo

CAS 1190875-47-8

:

B-(2-Methyl-5-thiazolyl)boronic acid

Description:
B-(2-Methyl-5-thiazolyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thiazole ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The thiazole moiety contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Boronic acids are known for their ability to form reversible covalent bonds with diols, which is significant in various applications, including drug design and molecular recognition. Additionally, this compound may participate in Suzuki-Miyaura cross-coupling reactions, a vital process in organic synthesis for forming carbon-carbon bonds. Its unique structure and reactivity make it a valuable building block in the synthesis of more complex molecules. As with many boronic acids, care should be taken in handling due to potential reactivity and the need for proper storage conditions to maintain stability.
Formula:C4H6BNO2S
InChI:InChI=1S/C4H6BNO2S/c1-3-6-2-4(9-3)5(7)8/h2,7-8H,1H3
InChI key:InChIKey=TXEARPNXPNJAQJ-UHFFFAOYSA-N
SMILES:B(O)(O)C=1SC(C)=NC1
Synonyms:
  • Boronic acid, B-(2-methyl-5-thiazolyl)-
  • (2-Methylthiazol-5-yl)boronic acid
  • B-(2-Methyl-5-thiazolyl)boronic acid
  • (2-Methyl-1,3-thiazol-5-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.