CAS 119089-68-8
:2-Amino-1,9-dihydro-9-[[1-(hydroxymethyl)-2-(phenylmethoxy)ethoxy]methyl]-6H-purin-6-one
Description:
2-Amino-1,9-dihydro-9-[[1-(hydroxymethyl)-2-(phenylmethoxy)ethoxy]methyl]-6H-purin-6-one, with CAS number 119089-68-8, is a purine derivative characterized by its complex molecular structure, which includes an amino group and a hydroxymethyl group. This compound typically exhibits properties associated with purines, such as potential biological activity, particularly in relation to nucleic acid metabolism. Its structure suggests it may interact with various biological targets, possibly influencing enzymatic pathways or cellular signaling. The presence of the phenylmethoxy group indicates potential lipophilicity, which could affect its solubility and permeability in biological systems. Additionally, the hydroxymethyl group may enhance its reactivity or stability under certain conditions. As with many purine analogs, this compound may be of interest in pharmaceutical research, particularly in the development of antiviral or anticancer agents. However, specific characteristics such as melting point, solubility, and biological activity would require empirical data for precise evaluation.
Formula:C16H19N5O4
InChI:InChI=1S/C16H19N5O4/c17-16-19-14-13(15(23)20-16)18-9-21(14)10-25-12(6-22)8-24-7-11-4-2-1-3-5-11/h1-5,9,12,22H,6-8,10H2,(H3,17,19,20,23)
InChI key:InChIKey=ONTNBCKQGVXWOE-UHFFFAOYSA-N
SMILES:C(OC(COCC1=CC=CC=C1)CO)N2C3=C(N=C2)C(=O)N=C(N)N3
Synonyms:- 2-Amino-1,9-dihydro-9-[[1-(hydroxymethyl)-2-(phenylmethoxy)ethoxy]methyl]-6H-purin-6-one
- 6H-Purin-6-one, 2-amino-1,9-dihydro-9-[[1-(hydroxymethyl)-2-(phenylmethoxy)ethoxy]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
