CAS 1190890-14-2

1,1-Dimethylethyl N-[2-[(2,2,2-trifluoroethyl)amino]ethyl]carbamate

Description:

1,1-Dimethylethyl N-[2-[(2,2,2-trifluoroethyl)amino]ethyl]carbamate, identified by its CAS number 1190890-14-2, is a chemical compound characterized by its unique structure that includes a carbamate functional group. This compound features a tert-butyl group (1,1-dimethylethyl) which contributes to its steric bulk, potentially influencing its reactivity and solubility. The presence of a trifluoroethyl group enhances its lipophilicity and may impart specific biological activities, making it of interest in pharmaceutical applications. The aminoethyl chain connects the carbamate to the trifluoroethyl moiety, suggesting potential interactions with biological targets. In terms of physical properties, compounds of this nature often exhibit moderate to high stability under standard conditions, but their behavior can vary significantly based on environmental factors such as pH and temperature. Additionally, the trifluoromethyl group can affect the compound's electronic properties, potentially influencing its reactivity and interactions in various chemical contexts. Overall, this compound's unique structural features make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₉H₁₇F₃N₂O₂

InChI: InChI=1S/C9H17F3N2O2/c1-8(2,3)16-7(15)14-5-4-13-6-9(10,11)12/h13H,4-6H2,1-3H3,(H,14,15)

InChI key: InChIKey=DKQRGTCZJUFLDF-UHFFFAOYSA-N

SMILES: O(C(C)(C)C)C(NCCNCC(F)(F)F)=O

Synonyms:

• tert-Butyl [2-[(2,2,2-trifluoroethyl)amino]ethyl]carbamate
• 1,1-Dimethylethyl N-[2-[(2,2,2-trifluoroethyl)amino]ethyl]carbamate
• Carbamic acid, N-[2-[(2,2,2-trifluoroethyl)amino]ethyl]-, 1,1-dimethylethyl ester