
CAS 1190927-26-4
:2-Chloro-6-fluorothiazolo[5,4-b]pyridine
Description:
2-Chloro-6-fluorothiazolo[5,4-b]pyridine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both thiazole and pyridine rings. This compound features a chlorine atom at the second position and a fluorine atom at the sixth position of the thiazolo-pyridine framework, contributing to its chemical reactivity and potential biological activity. The presence of halogens often enhances the lipophilicity and alters the electronic properties of the molecule, making it of interest in medicinal chemistry. The thiazole ring imparts sulfur-containing characteristics, which can influence the compound's interaction with biological targets. Additionally, the compound may exhibit various properties such as solubility in organic solvents and potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular geometry. As with many heterocycles, it may also exhibit interesting pharmacological properties, warranting further investigation in drug development contexts.
Formula:C6H2ClFN2S
InChI:InChI=1S/C6H2ClFN2S/c7-6-10-4-1-3(8)2-9-5(4)11-6/h1-2H
InChI key:InChIKey=PJMGQTJSCVPASY-UHFFFAOYSA-N
SMILES:ClC=1SC=2C(N1)=CC(F)=CN2
Synonyms:- 2-Chloro-6-fluorothiazolo[5,4-b]pyridine
- Thiazolo[5,4-b]pyridine, 2-chloro-6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.