
CAS 1190927-71-9
:1,1-Dimethylethyl N-(cyclopentylmethyl)carbamate
Description:
1,1-Dimethylethyl N-(cyclopentylmethyl)carbamate, identified by its CAS number 1190927-71-9, is an organic compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. The compound has a complex structure, incorporating a tert-butyl group (1,1-dimethylethyl) and a cyclopentylmethyl moiety, which contribute to its unique chemical properties. Typically, carbamates exhibit moderate stability and can be sensitive to hydrolysis, especially in the presence of strong acids or bases. They may also display biological activity, making them of interest in various fields, including agriculture and pharmaceuticals. The specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which the compound is studied. Safety data and handling precautions should be consulted due to potential toxicity associated with carbamate derivatives.
Formula:C11H21NO2
InChI:InChI=1S/C11H21NO2/c1-11(2,3)14-10(13)12-8-9-6-4-5-7-9/h9H,4-8H2,1-3H3,(H,12,13)
InChI key:InChIKey=KWALSAYHFOCNEE-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)C1CCCC1
Synonyms:- 1,1-Dimethylethyl N-(cyclopentylmethyl)carbamate
- Carbamic acid, N-(cyclopentylmethyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.