
CAS 1190931-27-1
:Acetic acid, 2,2-difluoro-2-[[2,2,4,5-tetrafluoro-5-(trifluoromethoxy)-1,3-dioxolan-4-yl]oxy]-, ammonium salt (1:1)
Description:
Acetic acid, 2,2-difluoro-2-[[2,2,4,5-tetrafluoro-5-(trifluoromethoxy)-1,3-dioxolan-4-yl]oxy]-, ammonium salt (1:1) is a complex fluorinated organic compound characterized by its unique structure that includes multiple fluorine atoms and a dioxolane ring. The presence of fluorine enhances its chemical stability and lipophilicity, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. As an ammonium salt, it exhibits ionic characteristics, which can influence its solubility and reactivity in different solvents. The compound's dioxolane moiety may contribute to its potential as a solvent or reagent in organic synthesis. Additionally, the presence of acetic acid suggests that it may participate in acid-base reactions. Overall, this compound's unique fluorinated structure and ionic nature may provide specific properties that are advantageous in specialized chemical applications, although detailed studies would be necessary to fully understand its behavior and potential uses in various fields.
Formula:C6HF9O6·H3N
InChI:InChI=1S/C6HF9O6.H3N/c7-2(8,1(16)17)18-3(9)4(10,19-5(11,12)13)21-6(14,15)20-3;/h(H,16,17);1H3
InChI key:InChIKey=JVXDZDPWHUBMPI-UHFFFAOYSA-N
SMILES:O(C(C(O)=O)(F)F)C1(F)C(OC(F)(F)F)(F)OC(F)(F)O1.N
Synonyms:- Acetic acid, 2,2-difluoro-2-[[2,2,4,5-tetrafluoro-5-(trifluoromethoxy)-1,3-dioxolan-4-yl]oxy]-, ammonium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-A-138057
Discontinued product

