CymitQuimica logo

CAS 1190971-27-7

:

2-Ethyl 5-(phenylmethyl) 6,7-dihydrothieno[3,2-c]pyridine-2,5(4H)-dicarboxylate

Description:
2-Ethyl 5-(phenylmethyl) 6,7-dihydrothieno[3,2-c]pyridine-2,5(4H)-dicarboxylate is a complex organic compound characterized by its unique bicyclic structure that incorporates both thieno and pyridine moieties. This compound features a dihydrothieno ring fused to a pyridine ring, which contributes to its potential biological activity. The presence of ethyl and phenylmethyl substituents enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The dicarboxylate functional groups suggest that it may participate in various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit interesting pharmacological properties due to its structural features, which could be explored in medicinal chemistry. Its CAS number, 1190971-27-7, allows for easy identification and retrieval of information regarding its synthesis, properties, and potential applications in research and industry. Overall, this compound represents a significant interest in the fields of organic chemistry and drug development.
Formula:C18H19NO4S
InChI:InChI=1S/C18H19NO4S/c1-2-22-17(20)16-10-14-11-19(9-8-15(14)24-16)18(21)23-12-13-6-4-3-5-7-13/h3-7,10H,2,8-9,11-12H2,1H3
InChI key:InChIKey=OCIURHWHZIUVOO-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC2=C(S1)CCN(C(OCC3=CC=CC=C3)=O)C2
Synonyms:
  • Thieno[3,2-c]pyridine-2,5(4H)-dicarboxylic acid, 6,7-dihydro-, 2-ethyl 5-(phenylmethyl) ester
  • 2-Ethyl 5-(phenylmethyl) 6,7-dihydrothieno[3,2-c]pyridine-2,5(4H)-dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.